C24H23NO4S — CID 45202865
2-[[2-(1,3-benzodioxol-5-yl)-8-methoxy-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]methyl]phenol (PubChem CID 45202865) has the molecular formula C24H23NO4S and a molecular weight of 421.52 g/mol. Its IUPAC name is 2-[[2-(1,3-benzodioxol-5-yl)-8-methoxy-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]methyl]phenol.
| Compound Name | 2-[[2-(1,3-benzodioxol-5-yl)-8-methoxy-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]methyl]phenol |
|---|---|
| PubChem CID | 45202865 |
| Molecular Formula | C24H23NO4S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 2-[[2-(1,3-benzodioxol-5-yl)-8-methoxy-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]methyl]phenol |
| SMILES | COc1ccc2c(c1)SC(c1ccc3c(c1)OCO3)CCN2Cc1ccccc1O |
| InChI | InChI=1S/C24H23NO4S/c1-27-18-7-8-19-24(13-18)30-23(16-6-9-21-22(12-16)29-15-28-21)10-11-25(19)14-17-4-2-3-5-20(17)26/h2-9,12-13,23,26H,10-11,14-15H2,1H3 |
| InChIKey | WXCDLIBATKIVLO-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|