C24H25NO3S — CID 45242971
4-methoxy-2-[[2-(3-methoxyphenyl)-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]methyl]phenol (PubChem CID 45242971) has the molecular formula C24H25NO3S and a molecular weight of 407.54 g/mol. Its IUPAC name is 4-methoxy-2-[[2-(3-methoxyphenyl)-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]methyl]phenol.
| Compound Name | 4-methoxy-2-[[2-(3-methoxyphenyl)-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]methyl]phenol |
|---|---|
| PubChem CID | 45242971 |
| Molecular Formula | C24H25NO3S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 4-methoxy-2-[[2-(3-methoxyphenyl)-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]methyl]phenol |
| SMILES | COc1cccc(C2CCN(Cc3cc(OC)ccc3O)c3ccccc3S2)c1 |
| InChI | InChI=1S/C24H25NO3S/c1-27-19-7-5-6-17(14-19)23-12-13-25(21-8-3-4-9-24(21)29-23)16-18-15-20(28-2)10-11-22(18)26/h3-11,14-15,23,26H,12-13,16H2,1-2H3 |
| InChIKey | ULTWHRAESIJJIP-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|