C24H24FNO3S — CID 26359055
2-[[(2R)-2-(3-fluorophenyl)-8-methoxy-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]methyl]-6-methoxyphenol (PubChem CID 26359055) has the molecular formula C24H24FNO3S and a molecular weight of 425.53 g/mol. Its IUPAC name is 2-[[(2R)-2-(3-fluorophenyl)-8-methoxy-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]methyl]-6-methoxyphenol.
| Compound Name | 2-[[(2R)-2-(3-fluorophenyl)-8-methoxy-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]methyl]-6-methoxyphenol |
|---|---|
| PubChem CID | 26359055 |
| Molecular Formula | C24H24FNO3S |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 2-[[(2R)-2-(3-fluorophenyl)-8-methoxy-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]methyl]-6-methoxyphenol |
| SMILES | COc1ccc2c(c1)S[C@@H](c1cccc(F)c1)CCN2Cc1cccc(OC)c1O |
| InChI | InChI=1S/C24H24FNO3S/c1-28-19-9-10-20-23(14-19)30-22(16-5-3-7-18(25)13-16)11-12-26(20)15-17-6-4-8-21(29-2)24(17)27/h3-10,13-14,22,27H,11-12,15H2,1-2H3/t22-/m1/s1 |
| InChIKey | ZQSJAETTWVUEIQ-JOCHJYFZSA-N |
| XLogP | 5.79 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|