C25H25NO5S — CID 45168640
2-[[2-(1,3-benzodioxol-5-yl)-8-methoxy-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]methyl]-4-methoxyphenol (PubChem CID 45168640) has the molecular formula C25H25NO5S and a molecular weight of 451.54 g/mol. Its IUPAC name is 2-[[2-(1,3-benzodioxol-5-yl)-8-methoxy-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]methyl]-4-methoxyphenol.
| Compound Name | 2-[[2-(1,3-benzodioxol-5-yl)-8-methoxy-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]methyl]-4-methoxyphenol |
|---|---|
| PubChem CID | 45168640 |
| Molecular Formula | C25H25NO5S |
| Molecular Weight | 451.54 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | 2-[[2-(1,3-benzodioxol-5-yl)-8-methoxy-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]methyl]-4-methoxyphenol |
| SMILES | COc1ccc(O)c(CN2CCC(c3ccc4c(c3)OCO4)Sc3cc(OC)ccc32)c1 |
| InChI | InChI=1S/C25H25NO5S/c1-28-18-5-7-21(27)17(11-18)14-26-10-9-24(16-3-8-22-23(12-16)31-15-30-22)32-25-13-19(29-2)4-6-20(25)26/h3-8,11-13,24,27H,9-10,14-15H2,1-2H3 |
| InChIKey | BWJXEJMVRBTCCG-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.54 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|