C27H25N3O3S — CID 42431423
(2S)-2-(1,3-benzodioxol-5-yl)-8-methoxy-5-[(5-phenyl-1H-pyrazol-4-yl)methyl]-3,4-dihydro-2H-1,5-benzothiazepine (PubChem CID 42431423) has the molecular formula C27H25N3O3S and a molecular weight of 471.58 g/mol. Its IUPAC name is (2S)-2-(1,3-benzodioxol-5-yl)-8-methoxy-5-[(5-phenyl-1H-pyrazol-4-yl)methyl]-3,4-dihydro-2H-1,5-benzothiazepine.
| Compound Name | (2S)-2-(1,3-benzodioxol-5-yl)-8-methoxy-5-[(5-phenyl-1H-pyrazol-4-yl)methyl]-3,4-dihydro-2H-1,5-benzothiazepine |
|---|---|
| PubChem CID | 42431423 |
| Molecular Formula | C27H25N3O3S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | (2S)-2-(1,3-benzodioxol-5-yl)-8-methoxy-5-[(5-phenyl-1H-pyrazol-4-yl)methyl]-3,4-dihydro-2H-1,5-benzothiazepine |
| SMILES | COc1ccc2c(c1)S[C@H](c1ccc3c(c1)OCO3)CCN2Cc1cn[nH]c1-c1ccccc1 |
| InChI | InChI=1S/C27H25N3O3S/c1-31-21-8-9-22-26(14-21)34-25(19-7-10-23-24(13-19)33-17-32-23)11-12-30(22)16-20-15-28-29-27(20)18-5-3-2-4-6-18/h2-10,13-15,25H,11-12,16-17H2,1H3,(H,28,29)/t25-/m0/s1 |
| InChIKey | ADBULOSFSONIRQ-VWLOTQADSA-N |
| XLogP | 6.06 |
| TPSA | 59.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|