C24H22N4O3S2 — CID 118753945
2-(1,3-benzodioxol-5-yl)-5-[[5-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]furan-2-yl]methyl]-3,4-dihydro-2H-1,5-benzothiazepine (PubChem CID 118753945) has the molecular formula C24H22N4O3S2 and a molecular weight of 478.60 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-5-[[5-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]furan-2-yl]methyl]-3,4-dihydro-2H-1,5-benzothiazepine.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-5-[[5-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]furan-2-yl]methyl]-3,4-dihydro-2H-1,5-benzothiazepine |
|---|---|
| PubChem CID | 118753945 |
| Molecular Formula | C24H22N4O3S2 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-5-[[5-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]furan-2-yl]methyl]-3,4-dihydro-2H-1,5-benzothiazepine |
| SMILES | Cn1cnnc1Sc1ccc(CN2CCC(c3ccc4c(c3)OCO4)Sc3ccccc32)o1 |
| InChI | InChI=1S/C24H22N4O3S2/c1-27-14-25-26-24(27)33-23-9-7-17(31-23)13-28-11-10-21(32-22-5-3-2-4-18(22)28)16-6-8-19-20(12-16)30-15-29-19/h2-9,12,14,21H,10-11,13,15H2,1H3 |
| InChIKey | XFHLXVZXOAKSPQ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 65.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |