C25H29N5OS — CID 45226895
1-cyclohexyl-2-[[5-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]furan-2-yl]methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 45226895) has the molecular formula C25H29N5OS and a molecular weight of 447.61 g/mol. Its IUPAC name is 1-cyclohexyl-2-[[5-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]furan-2-yl]methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 1-cyclohexyl-2-[[5-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]furan-2-yl]methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 45226895 |
| Molecular Formula | C25H29N5OS |
| Molecular Weight | 447.61 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | 1-cyclohexyl-2-[[5-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]furan-2-yl]methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | Cn1cnnc1Sc1ccc(CN2CCc3c([nH]c4ccccc34)C2C2CCCCC2)o1 |
| InChI | InChI=1S/C25H29N5OS/c1-29-16-26-28-25(29)32-22-12-11-18(31-22)15-30-14-13-20-19-9-5-6-10-21(19)27-23(20)24(30)17-7-3-2-4-8-17/h5-6,9-12,16-17,24,27H,2-4,7-8,13-15H2,1H3 |
| InChIKey | YFJFOZZLRDEAOJ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.61 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|