C29H35NO5S — CID 125155572
(2S)-8-ethoxy-5-[(2-ethoxyphenyl)methyl]-2-(3,4,5-trimethoxyphenyl)-3,4-dihydro-2H-1,5-benzothiazepine (PubChem CID 125155572) has the molecular formula C29H35NO5S and a molecular weight of 509.67 g/mol. Its IUPAC name is (2S)-8-ethoxy-5-[(2-ethoxyphenyl)methyl]-2-(3,4,5-trimethoxyphenyl)-3,4-dihydro-2H-1,5-benzothiazepine.
| Compound Name | (2S)-8-ethoxy-5-[(2-ethoxyphenyl)methyl]-2-(3,4,5-trimethoxyphenyl)-3,4-dihydro-2H-1,5-benzothiazepine |
|---|---|
| PubChem CID | 125155572 |
| Molecular Formula | C29H35NO5S |
| Molecular Weight | 509.67 g/mol |
| Exact Mass | 509.22 |
| IUPAC Name | (2S)-8-ethoxy-5-[(2-ethoxyphenyl)methyl]-2-(3,4,5-trimethoxyphenyl)-3,4-dihydro-2H-1,5-benzothiazepine |
| SMILES | CCOc1ccc2c(c1)S[C@H](c1cc(OC)c(OC)c(OC)c1)CCN2Cc1ccccc1OCC |
| InChI | InChI=1S/C29H35NO5S/c1-6-34-22-12-13-23-28(18-22)36-27(21-16-25(31-3)29(33-5)26(17-21)32-4)14-15-30(23)19-20-10-8-9-11-24(20)35-7-2/h8-13,16-18,27H,6-7,14-15,19H2,1-5H3/t27-/m0/s1 |
| InChIKey | IABHWVMEJLDTME-MHZLTWQESA-N |
| XLogP | 6.75 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.67 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|