C29H36N4O2 — CID 42499315
2-[2-[(4aR,8aR)-6-(3-methylbutyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-2-oxoethyl]-4-phenylphthalazin-1-one (PubChem CID 42499315) has the molecular formula C29H36N4O2 and a molecular weight of 472.63 g/mol. Its IUPAC name is 2-[2-[(4aR,8aR)-6-(3-methylbutyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-2-oxoethyl]-4-phenylphthalazin-1-one.
| Compound Name | 2-[2-[(4aR,8aR)-6-(3-methylbutyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-2-oxoethyl]-4-phenylphthalazin-1-one |
|---|---|
| PubChem CID | 42499315 |
| Molecular Formula | C29H36N4O2 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | 2-[2-[(4aR,8aR)-6-(3-methylbutyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-2-oxoethyl]-4-phenylphthalazin-1-one |
| SMILES | CC(C)CCN1CC[C@@H]2[C@H](CCCN2C(=O)Cn2nc(-c3ccccc3)c3ccccc3c2=O)C1 |
| InChI | InChI=1S/C29H36N4O2/c1-21(2)14-17-31-18-15-26-23(19-31)11-8-16-32(26)27(34)20-33-29(35)25-13-7-6-12-24(25)28(30-33)22-9-4-3-5-10-22/h3-7,9-10,12-13,21,23,26H,8,11,14-20H2,1-2H3/t23-,26-/m1/s1 |
| InChIKey | IHKWOIODTIKHDZ-ZEQKJWHPSA-N |
| XLogP | 4.42 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |