C19H35N3O3S — CID 42516192
[(2S)-1-[[3-butyl-2-(4-methylpentylsulfonyl)imidazol-4-yl]methyl]pyrrolidin-2-yl]methanol (PubChem CID 42516192) has the molecular formula C19H35N3O3S and a molecular weight of 385.57 g/mol. Its IUPAC name is [(2S)-1-[[3-butyl-2-(4-methylpentylsulfonyl)imidazol-4-yl]methyl]pyrrolidin-2-yl]methanol.
| Compound Name | [(2S)-1-[[3-butyl-2-(4-methylpentylsulfonyl)imidazol-4-yl]methyl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 42516192 |
| Molecular Formula | C19H35N3O3S |
| Molecular Weight | 385.57 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | [(2S)-1-[[3-butyl-2-(4-methylpentylsulfonyl)imidazol-4-yl]methyl]pyrrolidin-2-yl]methanol |
| SMILES | CCCCn1c(CN2CCC[C@H]2CO)cnc1S(=O)(=O)CCCC(C)C |
| InChI | InChI=1S/C19H35N3O3S/c1-4-5-11-22-18(14-21-10-6-9-17(21)15-23)13-20-19(22)26(24,25)12-7-8-16(2)3/h13,16-17,23H,4-12,14-15H2,1-3H3/t17-/m0/s1 |
| InChIKey | FHYBPIJNYKQCCO-KRWDZBQOSA-N |
| XLogP | 2.85 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.57 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |