About 3-benzylsulfonyl-N-(4,7-dichloro-3-methyl-1,3-benzothiazol-2-ylidene)propanamide
3-benzylsulfonyl-N-(4,7-dichloro-3-methyl-1,3-benzothiazol-2-ylidene)propanamide (PubChem CID 42523835) has the molecular formula C18H16Cl2N2O3S2
and a molecular weight of 443.38 g/mol. Its IUPAC name is 3-benzylsulfonyl-N-(4,7-dichloro-3-methyl-1,3-benzothiazol-2-ylidene)propanamide.
Molecular Properties
| Compound Name | 3-benzylsulfonyl-N-(4,7-dichloro-3-methyl-1,3-benzothiazol-2-ylidene)propanamide |
| PubChem CID | 42523835 |
| Molecular Formula | C18H16Cl2N2O3S2 |
| Molecular Weight | 443.38 g/mol |
| Exact Mass | 442.00 |
| IUPAC Name | 3-benzylsulfonyl-N-(4,7-dichloro-3-methyl-1,3-benzothiazol-2-ylidene)propanamide |
| SMILES | Cn1/c(=N/C(=O)CCS(=O)(=O)Cc2ccccc2)sc2c(Cl)ccc(Cl)c21 |
| InChI | InChI=1S/C18H16Cl2N2O3S2/c1-22-16-13(19)7-8-14(20)17(16)26-18(22)21-15(23)9-10-27(24,25)11-12-5-3-2-4-6-12/h2-8H,9-11H2,1H3/b21-18- |
| InChIKey | XQTWFDTXGNXOTC-UZYVYHOESA-N |
| XLogP | 3.98 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-benzylsulfonyl-N-(4,7-dichloro-3-methyl-1,3-benzothiazol-2-ylidene)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzylsulfonyl-N-(4,7-dichloro-3-methyl-1,3-benzothiazol-2-ylidene)propanamide?
The IUPAC name of 3-benzylsulfonyl-N-(4,7-dichloro-3-methyl-1,3-benzothiazol-2-ylidene)propanamide (CID 42523835) is 3-benzylsulfonyl-N-(4,7-dichloro-3-methyl-1,3-benzothiazol-2-ylidene)propanamide.
What is the SMILES notation for 3-benzylsulfonyl-N-(4,7-dichloro-3-methyl-1,3-benzothiazol-2-ylidene)propanamide?
The canonical SMILES for 3-benzylsulfonyl-N-(4,7-dichloro-3-methyl-1,3-benzothiazol-2-ylidene)propanamide is Cn1/c(=N/C(=O)CCS(=O)(=O)Cc2ccccc2)sc2c(Cl)ccc(Cl)c21.
What is the InChIKey of 3-benzylsulfonyl-N-(4,7-dichloro-3-methyl-1,3-benzothiazol-2-ylidene)propanamide?
The InChIKey is XQTWFDTXGNXOTC-UZYVYHOESA-N. The full InChI is InChI=1S/C18H16Cl2N2O3S2/c1-22-16-13(19)7-8-14(20)17(16)26-18(22)21-15(23)9-10-27(24,25)11-12-5-3-2-4-6-12/h2-8H,9-11H2,1H3/b21-18-.
What are the key properties of 3-benzylsulfonyl-N-(4,7-dichloro-3-methyl-1,3-benzothiazol-2-ylidene)propanamide?
3-benzylsulfonyl-N-(4,7-dichloro-3-methyl-1,3-benzothiazol-2-ylidene)propanamide has a molecular weight of 443.38 g/mol, XLogP of 3.98, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzylsulfonyl-N-(4,7-dichloro-3-methyl-1,3-benzothiazol-2-ylidene)propanamide is sourced from PubChem (CID 42523835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).