C22H26N2O5S2 — CID 42558212
4-benzylsulfonyl-N-(3-ethyl-4,7-dimethoxy-1,3-benzothiazol-2-ylidene)butanamide (PubChem CID 42558212) has the molecular formula C22H26N2O5S2 and a molecular weight of 462.59 g/mol. Its IUPAC name is 4-benzylsulfonyl-N-(3-ethyl-4,7-dimethoxy-1,3-benzothiazol-2-ylidene)butanamide.
| Compound Name | 4-benzylsulfonyl-N-(3-ethyl-4,7-dimethoxy-1,3-benzothiazol-2-ylidene)butanamide |
|---|---|
| PubChem CID | 42558212 |
| Molecular Formula | C22H26N2O5S2 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | 4-benzylsulfonyl-N-(3-ethyl-4,7-dimethoxy-1,3-benzothiazol-2-ylidene)butanamide |
| SMILES | CCn1/c(=N/C(=O)CCCS(=O)(=O)Cc2ccccc2)sc2c(OC)ccc(OC)c21 |
| InChI | InChI=1S/C22H26N2O5S2/c1-4-24-20-17(28-2)12-13-18(29-3)21(20)30-22(24)23-19(25)11-8-14-31(26,27)15-16-9-6-5-7-10-16/h5-7,9-10,12-13H,4,8,11,14-15H2,1-3H3/b23-22- |
| InChIKey | BBRITHVZOMKNNW-FCQUAONHSA-N |
| XLogP | 3.56 |
| TPSA | 86.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |