C23H29ClN2O2S — CID 42526551
5-chloro-2-(1-cyclopentylpiperidin-4-yl)oxy-N-methyl-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 42526551) has the molecular formula C23H29ClN2O2S and a molecular weight of 433.02 g/mol. Its IUPAC name is 5-chloro-2-(1-cyclopentylpiperidin-4-yl)oxy-N-methyl-N-(thiophen-2-ylmethyl)benzamide.
| Compound Name | 5-chloro-2-(1-cyclopentylpiperidin-4-yl)oxy-N-methyl-N-(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 42526551 |
| Molecular Formula | C23H29ClN2O2S |
| Molecular Weight | 433.02 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 5-chloro-2-(1-cyclopentylpiperidin-4-yl)oxy-N-methyl-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | CN(Cc1cccs1)C(=O)c1cc(Cl)ccc1OC1CCN(C2CCCC2)CC1 |
| InChI | InChI=1S/C23H29ClN2O2S/c1-25(16-20-7-4-14-29-20)23(27)21-15-17(24)8-9-22(21)28-19-10-12-26(13-11-19)18-5-2-3-6-18/h4,7-9,14-15,18-19H,2-3,5-6,10-13,16H2,1H3 |
| InChIKey | CLJRIUTVDNBXLF-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.02 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |