C19H17N5O — CID 42531849
5-(1-benzofuran-2-yl)-N-(3-pyridin-3-ylpropyl)-1,2,4-triazin-3-amine (PubChem CID 42531849) has the molecular formula C19H17N5O and a molecular weight of 331.38 g/mol. Its IUPAC name is 5-(1-benzofuran-2-yl)-N-(3-pyridin-3-ylpropyl)-1,2,4-triazin-3-amine.
| Compound Name | 5-(1-benzofuran-2-yl)-N-(3-pyridin-3-ylpropyl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 42531849 |
| Molecular Formula | C19H17N5O |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 5-(1-benzofuran-2-yl)-N-(3-pyridin-3-ylpropyl)-1,2,4-triazin-3-amine |
| SMILES | c1cncc(CCCNc2nncc(-c3cc4ccccc4o3)n2)c1 |
| InChI | InChI=1S/C19H17N5O/c1-2-8-17-15(7-1)11-18(25-17)16-13-22-24-19(23-16)21-10-4-6-14-5-3-9-20-12-14/h1-3,5,7-9,11-13H,4,6,10H2,(H,21,23,24) |
| InChIKey | VPRZYTVKVMWFSP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 76.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|