C21H21N5O2S — CID 42535786
(6S)-3-ethyl-5-[2-[(2Z)-2-(furan-2-ylmethylidene)hydrazinyl]-1,3-thiazol-4-yl]-6-(4-methylphenyl)-1,6-dihydropyrimidin-2-one (PubChem CID 42535786) has the molecular formula C21H21N5O2S and a molecular weight of 407.50 g/mol. Its IUPAC name is (6S)-3-ethyl-5-[2-[(2Z)-2-(furan-2-ylmethylidene)hydrazinyl]-1,3-thiazol-4-yl]-6-(4-methylphenyl)-1,6-dihydropyrimidin-2-one.
| Compound Name | (6S)-3-ethyl-5-[2-[(2Z)-2-(furan-2-ylmethylidene)hydrazinyl]-1,3-thiazol-4-yl]-6-(4-methylphenyl)-1,6-dihydropyrimidin-2-one |
|---|---|
| PubChem CID | 42535786 |
| Molecular Formula | C21H21N5O2S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | (6S)-3-ethyl-5-[2-[(2Z)-2-(furan-2-ylmethylidene)hydrazinyl]-1,3-thiazol-4-yl]-6-(4-methylphenyl)-1,6-dihydropyrimidin-2-one |
| SMILES | CCN1C=C(c2csc(N/N=C\c3ccco3)n2)[C@H](c2ccc(C)cc2)NC1=O |
| InChI | InChI=1S/C21H21N5O2S/c1-3-26-12-17(19(24-21(26)27)15-8-6-14(2)7-9-15)18-13-29-20(23-18)25-22-11-16-5-4-10-28-16/h4-13,19H,3H2,1-2H3,(H,23,25)(H,24,27)/b22-11-/t19-/m0/s1 |
| InChIKey | NUQPUVDHKXVEAE-SNINMWPCSA-N |
| XLogP | 4.62 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_furan_A(6)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|