C21H19ClF3N3O4 — CID 42543434
[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 1-[4-(trifluoromethyl)benzoyl]piperidine-4-carboxylate (PubChem CID 42543434) has the molecular formula C21H19ClF3N3O4 and a molecular weight of 469.85 g/mol. Its IUPAC name is [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 1-[4-(trifluoromethyl)benzoyl]piperidine-4-carboxylate.
| Compound Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 1-[4-(trifluoromethyl)benzoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 42543434 |
| Molecular Formula | C21H19ClF3N3O4 |
| Molecular Weight | 469.85 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 1-[4-(trifluoromethyl)benzoyl]piperidine-4-carboxylate |
| SMILES | O=C(COC(=O)C1CCN(C(=O)c2ccc(C(F)(F)F)cc2)CC1)Nc1cccnc1Cl |
| InChI | InChI=1S/C21H19ClF3N3O4/c22-18-16(2-1-9-26-18)27-17(29)12-32-20(31)14-7-10-28(11-8-14)19(30)13-3-5-15(6-4-13)21(23,24)25/h1-6,9,14H,7-8,10-12H2,(H,27,29) |
| InChIKey | GTIONIYUDOZRHZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.85 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|