C32H38N2O2 — CID 42554259
(E)-1-[6-[(4R)-1-[(E)-but-2-enoyl]-2,2,4-trimethyl-3H-quinolin-4-yl]-2,2,4-trimethylquinolin-1-yl]but-2-en-1-one (PubChem CID 42554259) has the molecular formula C32H38N2O2 and a molecular weight of 482.67 g/mol. Its IUPAC name is (E)-1-[6-[(4R)-1-[(E)-but-2-enoyl]-2,2,4-trimethyl-3H-quinolin-4-yl]-2,2,4-trimethylquinolin-1-yl]but-2-en-1-one.
| Compound Name | (E)-1-[6-[(4R)-1-[(E)-but-2-enoyl]-2,2,4-trimethyl-3H-quinolin-4-yl]-2,2,4-trimethylquinolin-1-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 42554259 |
| Molecular Formula | C32H38N2O2 |
| Molecular Weight | 482.67 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | (E)-1-[6-[(4R)-1-[(E)-but-2-enoyl]-2,2,4-trimethyl-3H-quinolin-4-yl]-2,2,4-trimethylquinolin-1-yl]but-2-en-1-one |
| SMILES | C/C=C/C(=O)N1c2ccc([C@@]3(C)CC(C)(C)N(C(=O)/C=C/C)c4ccccc43)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C32H38N2O2/c1-9-13-28(35)33-26-18-17-23(19-24(26)22(3)20-30(33,4)5)32(8)21-31(6,7)34(29(36)14-10-2)27-16-12-11-15-25(27)32/h9-20H,21H2,1-8H3/b13-9+,14-10+/t32-/m1/s1 |
| InChIKey | YTVGYYZDIWWMEV-VFPRJWKXSA-N |
| XLogP | 7.19 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.67 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|