C22H19N4O3S+ — CID 42569168
2-(1,3-benzothiazol-3-ium-2-yl)-5-[(4-methoxyphenyl)methyl]-4-methyl-1H-pyrazolo[4,3-c]pyridine-3,6-dione (PubChem CID 42569168) has the molecular formula C22H19N4O3S+ and a molecular weight of 419.49 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-3-ium-2-yl)-5-[(4-methoxyphenyl)methyl]-4-methyl-1H-pyrazolo[4,3-c]pyridine-3,6-dione.
| Compound Name | 2-(1,3-benzothiazol-3-ium-2-yl)-5-[(4-methoxyphenyl)methyl]-4-methyl-1H-pyrazolo[4,3-c]pyridine-3,6-dione |
|---|---|
| PubChem CID | 42569168 |
| Molecular Formula | C22H19N4O3S+ |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 2-(1,3-benzothiazol-3-ium-2-yl)-5-[(4-methoxyphenyl)methyl]-4-methyl-1H-pyrazolo[4,3-c]pyridine-3,6-dione |
| SMILES | COc1ccc(Cn2c(C)c3c(=O)n(-c4[nH+]c5ccccc5s4)[nH]c3cc2=O)cc1 |
| InChI | InChI=1S/C22H18N4O3S/c1-13-20-17(11-19(27)25(13)12-14-7-9-15(29-2)10-8-14)24-26(21(20)28)22-23-16-5-3-4-6-18(16)30-22/h3-11,24H,12H2,1-2H3/p+1 |
| InChIKey | HLGMLVFWUUHBDV-UHFFFAOYSA-O |
| XLogP | 2.87 |
| TPSA | 83.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|