C25H26N6O2S2 — CID 42578367
(4R)-2-amino-1',7,7-trimethyl-2',5-dioxo-1-(5-propan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)spiro[6,8-dihydroquinoline-4,3'-indole]-3-carbonitrile (PubChem CID 42578367) has the molecular formula C25H26N6O2S2 and a molecular weight of 506.66 g/mol. Its IUPAC name is (4R)-2-amino-1',7,7-trimethyl-2',5-dioxo-1-(5-propan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)spiro[6,8-dihydroquinoline-4,3'-indole]-3-carbonitrile.
| Compound Name | (4R)-2-amino-1',7,7-trimethyl-2',5-dioxo-1-(5-propan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)spiro[6,8-dihydroquinoline-4,3'-indole]-3-carbonitrile |
|---|---|
| PubChem CID | 42578367 |
| Molecular Formula | C25H26N6O2S2 |
| Molecular Weight | 506.66 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | (4R)-2-amino-1',7,7-trimethyl-2',5-dioxo-1-(5-propan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)spiro[6,8-dihydroquinoline-4,3'-indole]-3-carbonitrile |
| SMILES | CC(C)Sc1nnc(N2C(N)=C(C#N)[C@@]3(C(=O)N(C)c4ccccc43)C3=C2CC(C)(C)CC3=O)s1 |
| InChI | InChI=1S/C25H26N6O2S2/c1-13(2)34-23-29-28-22(35-23)31-17-10-24(3,4)11-18(32)19(17)25(15(12-26)20(31)27)14-8-6-7-9-16(14)30(5)21(25)33/h6-9,13H,10-11,27H2,1-5H3/t25-/m1/s1 |
| InChIKey | AZMADIRUPOTRGZ-RUZDIDTESA-N |
| XLogP | 4.11 |
| TPSA | 116.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.66 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |