C23H22N6O2S2 — CID 4920216
2'-amino-5,7',7'-trimethyl-1'-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)-2,5'-dioxospiro[1H-indole-3,4'-6,8-dihydroquinoline]-3'-carbonitrile (PubChem CID 4920216) has the molecular formula C23H22N6O2S2 and a molecular weight of 478.60 g/mol. Its IUPAC name is 2'-amino-5,7',7'-trimethyl-1'-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)-2,5'-dioxospiro[1H-indole-3,4'-6,8-dihydroquinoline]-3'-carbonitrile.
| Compound Name | 2'-amino-5,7',7'-trimethyl-1'-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)-2,5'-dioxospiro[1H-indole-3,4'-6,8-dihydroquinoline]-3'-carbonitrile |
|---|---|
| PubChem CID | 4920216 |
| Molecular Formula | C23H22N6O2S2 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | 2'-amino-5,7',7'-trimethyl-1'-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)-2,5'-dioxospiro[1H-indole-3,4'-6,8-dihydroquinoline]-3'-carbonitrile |
| SMILES | CSc1nnc(N2C(N)=C(C#N)C3(C(=O)Nc4ccc(C)cc43)C3=C2CC(C)(C)CC3=O)s1 |
| InChI | InChI=1S/C23H22N6O2S2/c1-11-5-6-14-12(7-11)23(19(31)26-14)13(10-24)18(25)29(20-27-28-21(32-4)33-20)15-8-22(2,3)9-16(30)17(15)23/h5-7H,8-9,25H2,1-4H3,(H,26,31) |
| InChIKey | ZRTUUDMQPZUJBY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 125.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |