C24H21FN6O2S2 — CID 4920308
2'-amino-5-fluoro-7',7'-dimethyl-2,5'-dioxo-1'-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)spiro[1H-indole-3,4'-6,8-dihydroquinoline]-3'-carbonitrile (PubChem CID 4920308) has the molecular formula C24H21FN6O2S2 and a molecular weight of 508.60 g/mol. Its IUPAC name is 2'-amino-5-fluoro-7',7'-dimethyl-2,5'-dioxo-1'-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)spiro[1H-indole-3,4'-6,8-dihydroquinoline]-3'-carbonitrile.
| Compound Name | 2'-amino-5-fluoro-7',7'-dimethyl-2,5'-dioxo-1'-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)spiro[1H-indole-3,4'-6,8-dihydroquinoline]-3'-carbonitrile |
|---|---|
| PubChem CID | 4920308 |
| Molecular Formula | C24H21FN6O2S2 |
| Molecular Weight | 508.60 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | 2'-amino-5-fluoro-7',7'-dimethyl-2,5'-dioxo-1'-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)spiro[1H-indole-3,4'-6,8-dihydroquinoline]-3'-carbonitrile |
| SMILES | C=CCSc1nnc(N2C(N)=C(C#N)C3(C(=O)Nc4ccc(F)cc43)C3=C2CC(C)(C)CC3=O)s1 |
| InChI | InChI=1S/C24H21FN6O2S2/c1-4-7-34-22-30-29-21(35-22)31-16-9-23(2,3)10-17(32)18(16)24(14(11-26)19(31)27)13-8-12(25)5-6-15(13)28-20(24)33/h4-6,8H,1,7,9-10,27H2,2-3H3,(H,28,33) |
| InChIKey | QLPKLSZNSBDQID-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 125.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.60 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|