C24H22N4O6S — CID 42588560
(4-morpholin-4-yl-1,2,5-thiadiazol-3-yl) (3S)-3-(1,3-dioxoisoindol-2-yl)-3-(4-methoxyphenyl)propanoate (PubChem CID 42588560) has the molecular formula C24H22N4O6S and a molecular weight of 494.53 g/mol. Its IUPAC name is (4-morpholin-4-yl-1,2,5-thiadiazol-3-yl) (3S)-3-(1,3-dioxoisoindol-2-yl)-3-(4-methoxyphenyl)propanoate.
| Compound Name | (4-morpholin-4-yl-1,2,5-thiadiazol-3-yl) (3S)-3-(1,3-dioxoisoindol-2-yl)-3-(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 42588560 |
| Molecular Formula | C24H22N4O6S |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | (4-morpholin-4-yl-1,2,5-thiadiazol-3-yl) (3S)-3-(1,3-dioxoisoindol-2-yl)-3-(4-methoxyphenyl)propanoate |
| SMILES | COc1ccc([C@H](CC(=O)Oc2nsnc2N2CCOCC2)N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C24H22N4O6S/c1-32-16-8-6-15(7-9-16)19(28-23(30)17-4-2-3-5-18(17)24(28)31)14-20(29)34-22-21(25-35-26-22)27-10-12-33-13-11-27/h2-9,19H,10-14H2,1H3/t19-/m0/s1 |
| InChIKey | OCOJYHONPCIILS-IBGZPJMESA-N |
| XLogP | 2.72 |
| TPSA | 111.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|