C15H18N6O3S — CID 42426581
[(Z)-[2-[(4-morpholin-4-yl-1,2,5-thiadiazol-3-yl)oxy]-1-phenylethylidene]amino]urea (PubChem CID 42426581) has the molecular formula C15H18N6O3S and a molecular weight of 362.42 g/mol. Its IUPAC name is [(Z)-[2-[(4-morpholin-4-yl-1,2,5-thiadiazol-3-yl)oxy]-1-phenylethylidene]amino]urea.
| Compound Name | [(Z)-[2-[(4-morpholin-4-yl-1,2,5-thiadiazol-3-yl)oxy]-1-phenylethylidene]amino]urea |
|---|---|
| PubChem CID | 42426581 |
| Molecular Formula | C15H18N6O3S |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | [(Z)-[2-[(4-morpholin-4-yl-1,2,5-thiadiazol-3-yl)oxy]-1-phenylethylidene]amino]urea |
| SMILES | NC(=O)N/N=C(\COc1nsnc1N1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C15H18N6O3S/c16-15(22)18-17-12(11-4-2-1-3-5-11)10-24-14-13(19-25-20-14)21-6-8-23-9-7-21/h1-5H,6-10H2,(H3,16,18,22)/b17-12+ |
| InChIKey | JBAGDODEFIJSPD-SFQUDFHCSA-N |
| XLogP | 0.83 |
| TPSA | 114.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|