C20H19N7O6S — CID 16643988
N-[(E)-[2-[(4-morpholin-4-yl-1,2,5-thiadiazol-3-yl)oxy]-1-phenylethylidene]amino]-2,4-dinitroaniline (PubChem CID 16643988) has the molecular formula C20H19N7O6S and a molecular weight of 485.48 g/mol. Its IUPAC name is N-[(E)-[2-[(4-morpholin-4-yl-1,2,5-thiadiazol-3-yl)oxy]-1-phenylethylidene]amino]-2,4-dinitroaniline.
| Compound Name | N-[(E)-[2-[(4-morpholin-4-yl-1,2,5-thiadiazol-3-yl)oxy]-1-phenylethylidene]amino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 16643988 |
| Molecular Formula | C20H19N7O6S |
| Molecular Weight | 485.48 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | N-[(E)-[2-[(4-morpholin-4-yl-1,2,5-thiadiazol-3-yl)oxy]-1-phenylethylidene]amino]-2,4-dinitroaniline |
| SMILES | O=[N+]([O-])c1ccc(N/N=C(/COc2nsnc2N2CCOCC2)c2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H19N7O6S/c28-26(29)15-6-7-16(18(12-15)27(30)31)21-22-17(14-4-2-1-3-5-14)13-33-20-19(23-34-24-20)25-8-10-32-11-9-25/h1-7,12,21H,8-11,13H2/b22-17- |
| InChIKey | RMLBMMUUTNDHOF-XLNRJJMWSA-N |
| XLogP | 3.09 |
| TPSA | 158.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|