C21H20N4O — CID 42598159
(E)-N-methoxy-6-piperazin-1-ylindeno[1,2-c]quinolin-11-imine (PubChem CID 42598159) has the molecular formula C21H20N4O and a molecular weight of 344.42 g/mol. Its IUPAC name is (E)-N-methoxy-6-piperazin-1-ylindeno[1,2-c]quinolin-11-imine.
| Compound Name | (E)-N-methoxy-6-piperazin-1-ylindeno[1,2-c]quinolin-11-imine |
|---|---|
| PubChem CID | 42598159 |
| Molecular Formula | C21H20N4O |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (E)-N-methoxy-6-piperazin-1-ylindeno[1,2-c]quinolin-11-imine |
| SMILES | CO/N=C1\c2ccccc2-c2c(N3CCNCC3)nc3ccccc3c21 |
| InChI | InChI=1S/C21H20N4O/c1-26-24-20-15-7-3-2-6-14(15)19-18(20)16-8-4-5-9-17(16)23-21(19)25-12-10-22-11-13-25/h2-9,22H,10-13H2,1H3/b24-20+ |
| InChIKey | REYMBJLTZWJYPD-HIXSDJFHSA-N |
| XLogP | 3.02 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|