C22H21N3O3 — CID 68770621
8,9-dimethoxy-6-piperazin-1-ylindeno[1,2-c]quinolin-11-one (PubChem CID 68770621) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is 8,9-dimethoxy-6-piperazin-1-ylindeno[1,2-c]quinolin-11-one.
| Compound Name | 8,9-dimethoxy-6-piperazin-1-ylindeno[1,2-c]quinolin-11-one |
|---|---|
| PubChem CID | 68770621 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 8,9-dimethoxy-6-piperazin-1-ylindeno[1,2-c]quinolin-11-one |
| SMILES | COc1cc2c(cc1OC)-c1c(N3CCNCC3)nc3ccccc3c1C2=O |
| InChI | InChI=1S/C22H21N3O3/c1-27-17-11-14-15(12-18(17)28-2)21(26)19-13-5-3-4-6-16(13)24-22(20(14)19)25-9-7-23-8-10-25/h3-6,11-12,23H,7-10H2,1-2H3 |
| InChIKey | AABPBPIJVQQZTK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |