C26H31N5O2 — CID 74369056
3-[(9-methoxy-6-piperazin-1-ylindeno[1,2-c]quinolin-11-ylidene)amino]oxy-N,N-dimethylpropan-1-amine (PubChem CID 74369056) has the molecular formula C26H31N5O2 and a molecular weight of 445.57 g/mol. Its IUPAC name is 3-[(9-methoxy-6-piperazin-1-ylindeno[1,2-c]quinolin-11-ylidene)amino]oxy-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[(9-methoxy-6-piperazin-1-ylindeno[1,2-c]quinolin-11-ylidene)amino]oxy-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 74369056 |
| Molecular Formula | C26H31N5O2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | 3-[(9-methoxy-6-piperazin-1-ylindeno[1,2-c]quinolin-11-ylidene)amino]oxy-N,N-dimethylpropan-1-amine |
| SMILES | COc1ccc2c(c1)C(=NOCCCN(C)C)c1c-2c(N2CCNCC2)nc2ccccc12 |
| InChI | InChI=1S/C26H31N5O2/c1-30(2)13-6-16-33-29-25-21-17-18(32-3)9-10-19(21)24-23(25)20-7-4-5-8-22(20)28-26(24)31-14-11-27-12-15-31/h4-5,7-10,17,27H,6,11-16H2,1-3H3 |
| InChIKey | PNUJPTIHYOIYLV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|