C11H10F3N3O4 — CID 42598983
4-methoxy-7-nitro-2-(trifluoromethyl)-1,3-dihydro-1,5-benzodiazepin-2-ol (PubChem CID 42598983) has the molecular formula C11H10F3N3O4 and a molecular weight of 305.21 g/mol. Its IUPAC name is 4-methoxy-7-nitro-2-(trifluoromethyl)-1,3-dihydro-1,5-benzodiazepin-2-ol.
| Compound Name | 4-methoxy-7-nitro-2-(trifluoromethyl)-1,3-dihydro-1,5-benzodiazepin-2-ol |
|---|---|
| PubChem CID | 42598983 |
| Molecular Formula | C11H10F3N3O4 |
| Molecular Weight | 305.21 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 4-methoxy-7-nitro-2-(trifluoromethyl)-1,3-dihydro-1,5-benzodiazepin-2-ol |
| SMILES | COC1=Nc2cc([N+](=O)[O-])ccc2NC(O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C11H10F3N3O4/c1-21-9-5-10(18,11(12,13)14)16-7-3-2-6(17(19)20)4-8(7)15-9/h2-4,16,18H,5H2,1H3 |
| InChIKey | GOPMWFDPWRUNNS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 96.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.21 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|