C18H24N2O3 — CID 42599455
(2E,4E)-N-[6-(hydroxyamino)-6-oxohexyl]-3-methyl-5-phenylpenta-2,4-dienamide (PubChem CID 42599455) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is (2E,4E)-N-[6-(hydroxyamino)-6-oxohexyl]-3-methyl-5-phenylpenta-2,4-dienamide.
| Compound Name | (2E,4E)-N-[6-(hydroxyamino)-6-oxohexyl]-3-methyl-5-phenylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 42599455 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | (2E,4E)-N-[6-(hydroxyamino)-6-oxohexyl]-3-methyl-5-phenylpenta-2,4-dienamide |
| SMILES | CC(/C=C/c1ccccc1)=C\C(=O)NCCCCCC(=O)NO |
| InChI | InChI=1S/C18H24N2O3/c1-15(11-12-16-8-4-2-5-9-16)14-18(22)19-13-7-3-6-10-17(21)20-23/h2,4-5,8-9,11-12,14,23H,3,6-7,10,13H2,1H3,(H,19,22)(H,20,21)/b12-11+,15-14+ |
| InChIKey | FIMYEORZUZGRFU-TVYVBBRWSA-N |
| XLogP | 2.83 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|