C20H25N3O — CID 42604562
(2R,5S,9R)-3-cyclohexyl-4-oxa-3,11,18-triazapentacyclo[9.7.0.02,9.05,9.012,17]octadeca-1(18),12,14,16-tetraene (PubChem CID 42604562) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is (2R,5S,9R)-3-cyclohexyl-4-oxa-3,11,18-triazapentacyclo[9.7.0.02,9.05,9.012,17]octadeca-1(18),12,14,16-tetraene.
| Compound Name | (2R,5S,9R)-3-cyclohexyl-4-oxa-3,11,18-triazapentacyclo[9.7.0.02,9.05,9.012,17]octadeca-1(18),12,14,16-tetraene |
|---|---|
| PubChem CID | 42604562 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | (2R,5S,9R)-3-cyclohexyl-4-oxa-3,11,18-triazapentacyclo[9.7.0.02,9.05,9.012,17]octadeca-1(18),12,14,16-tetraene |
| SMILES | c1ccc2c(c1)nc1n2C[C@@]23CCC[C@@H]2ON(C2CCCCC2)[C@@H]13 |
| InChI | InChI=1S/C20H25N3O/c1-2-7-14(8-3-1)23-18-19-21-15-9-4-5-10-16(15)22(19)13-20(18)12-6-11-17(20)24-23/h4-5,9-10,14,17-18H,1-3,6-8,11-13H2/t17-,18-,20-/m0/s1 |
| InChIKey | PEEYVXWHUQFIDI-BJLQDIEVSA-N |
| XLogP | 4.21 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |