C19H15F3N4O3 — CID 4260575
N-[1-(1,3-benzodioxol-5-yl)ethylideneamino]-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetamide (PubChem CID 4260575) has the molecular formula C19H15F3N4O3 and a molecular weight of 404.35 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-yl)ethylideneamino]-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetamide.
| Compound Name | N-[1-(1,3-benzodioxol-5-yl)ethylideneamino]-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 4260575 |
| Molecular Formula | C19H15F3N4O3 |
| Molecular Weight | 404.35 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-yl)ethylideneamino]-2-[2-(trifluoromethyl)benzimidazol-1-yl]acetamide |
| SMILES | CC(=NNC(=O)Cn1c(C(F)(F)F)nc2ccccc21)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H15F3N4O3/c1-11(12-6-7-15-16(8-12)29-10-28-15)24-25-17(27)9-26-14-5-3-2-4-13(14)23-18(26)19(20,21)22/h2-8H,9-10H2,1H3,(H,25,27) |
| InChIKey | KXFDAWFIAMEFDK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|