C19H18N4O3 — CID 9121439
N-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]-2-(2-methylbenzimidazol-1-yl)acetamide (PubChem CID 9121439) has the molecular formula C19H18N4O3 and a molecular weight of 350.38 g/mol. Its IUPAC name is N-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]-2-(2-methylbenzimidazol-1-yl)acetamide.
| Compound Name | N-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]-2-(2-methylbenzimidazol-1-yl)acetamide |
|---|---|
| PubChem CID | 9121439 |
| Molecular Formula | C19H18N4O3 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | N-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]-2-(2-methylbenzimidazol-1-yl)acetamide |
| SMILES | C/C(=N/NC(=O)Cn1c(C)nc2ccccc21)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H18N4O3/c1-12(14-7-8-17-18(9-14)26-11-25-17)21-22-19(24)10-23-13(2)20-15-5-3-4-6-16(15)23/h3-9H,10-11H2,1-2H3,(H,22,24)/b21-12- |
| InChIKey | RBHMKWIRCFWJEE-MTJSOVHGSA-N |
| XLogP | 2.61 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|