C20H21N3O3 — CID 9258468
N-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]-2-(3,4-dihydro-2H-quinolin-1-yl)acetamide (PubChem CID 9258468) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is N-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]-2-(3,4-dihydro-2H-quinolin-1-yl)acetamide.
| Compound Name | N-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]-2-(3,4-dihydro-2H-quinolin-1-yl)acetamide |
|---|---|
| PubChem CID | 9258468 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | N-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]-2-(3,4-dihydro-2H-quinolin-1-yl)acetamide |
| SMILES | C/C(=N/NC(=O)CN1CCCc2ccccc21)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H21N3O3/c1-14(16-8-9-18-19(11-16)26-13-25-18)21-22-20(24)12-23-10-4-6-15-5-2-3-7-17(15)23/h2-3,5,7-9,11H,4,6,10,12-13H2,1H3,(H,22,24)/b21-14- |
| InChIKey | GHSVSGVSSSOIOT-STZFKDTASA-N |
| XLogP | 2.71 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|