C17H19N3OS — CID 9258315
2-(3,4-dihydro-2H-quinolin-1-yl)-N-[(Z)-1-thiophen-2-ylethylideneamino]acetamide (PubChem CID 9258315) has the molecular formula C17H19N3OS and a molecular weight of 313.43 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-quinolin-1-yl)-N-[(Z)-1-thiophen-2-ylethylideneamino]acetamide.
| Compound Name | 2-(3,4-dihydro-2H-quinolin-1-yl)-N-[(Z)-1-thiophen-2-ylethylideneamino]acetamide |
|---|---|
| PubChem CID | 9258315 |
| Molecular Formula | C17H19N3OS |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 2-(3,4-dihydro-2H-quinolin-1-yl)-N-[(Z)-1-thiophen-2-ylethylideneamino]acetamide |
| SMILES | C/C(=N/NC(=O)CN1CCCc2ccccc21)c1cccs1 |
| InChI | InChI=1S/C17H19N3OS/c1-13(16-9-5-11-22-16)18-19-17(21)12-20-10-4-7-14-6-2-3-8-15(14)20/h2-3,5-6,8-9,11H,4,7,10,12H2,1H3,(H,19,21)/b18-13- |
| InChIKey | BQHICOSEDNPLAJ-AQTBWJFISA-N |
| XLogP | 3.04 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|