C14H22N2O6Pt — CID 42610849
3-acetyloxycyclobutane-1,1-dicarboxylate;[2-(aminomethyl)cyclobutyl]methanamine;platinum(2+) (PubChem CID 42610849) has the molecular formula C14H22N2O6Pt and a molecular weight of 509.42 g/mol. Its IUPAC name is 3-acetyloxycyclobutane-1,1-dicarboxylate;[2-(aminomethyl)cyclobutyl]methanamine;platinum(2+).
| Compound Name | 3-acetyloxycyclobutane-1,1-dicarboxylate;[2-(aminomethyl)cyclobutyl]methanamine;platinum(2+) |
|---|---|
| PubChem CID | 42610849 |
| Molecular Formula | C14H22N2O6Pt |
| Molecular Weight | 509.42 g/mol |
| Exact Mass | 509.11 |
| IUPAC Name | 3-acetyloxycyclobutane-1,1-dicarboxylate;[2-(aminomethyl)cyclobutyl]methanamine;platinum(2+) |
| SMILES | CC(=O)OC1CC(C(=O)[O-])(C(=O)[O-])C1.NCC1CCC1CN.[Pt+2] |
| InChI | InChI=1S/C8H10O6.C6H14N2.Pt/c1-4(9)14-5-2-8(3-5,6(10)11)7(12)13;7-3-5-1-2-6(5)4-8;/h5H,2-3H2,1H3,(H,10,11)(H,12,13);5-6H,1-4,7-8H2;/q;;+2/p-2 |
| InChIKey | SSPSKDGDYWLGPO-UHFFFAOYSA-L |
| XLogP | -2.87 |
| TPSA | 158.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.42 |
| LogP ≤ 5 | -2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|