C24H19FN2O5S — CID 42624809
methyl 3-[[2-[1-[(4-fluorophenyl)methyl]-4-methoxyindol-3-yl]-2-oxoacetyl]amino]thiophene-2-carboxylate (PubChem CID 42624809) has the molecular formula C24H19FN2O5S and a molecular weight of 466.49 g/mol. Its IUPAC name is methyl 3-[[2-[1-[(4-fluorophenyl)methyl]-4-methoxyindol-3-yl]-2-oxoacetyl]amino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[[2-[1-[(4-fluorophenyl)methyl]-4-methoxyindol-3-yl]-2-oxoacetyl]amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 42624809 |
| Molecular Formula | C24H19FN2O5S |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | methyl 3-[[2-[1-[(4-fluorophenyl)methyl]-4-methoxyindol-3-yl]-2-oxoacetyl]amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)C(=O)c1cn(Cc2ccc(F)cc2)c2cccc(OC)c12 |
| InChI | InChI=1S/C24H19FN2O5S/c1-31-19-5-3-4-18-20(19)16(13-27(18)12-14-6-8-15(25)9-7-14)21(28)23(29)26-17-10-11-33-22(17)24(30)32-2/h3-11,13H,12H2,1-2H3,(H,26,29) |
| InChIKey | FAFGUQZFTLJVMK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|