C26H41NO4 — CID 42633464
cyclohexylmethyl 4-[[(2S,3S)-1,1-diethyl-7-hydroxy-3-methoxy-3,4-dihydro-2H-naphthalen-2-yl]amino]butanoate (PubChem CID 42633464) has the molecular formula C26H41NO4 and a molecular weight of 431.62 g/mol. Its IUPAC name is cyclohexylmethyl 4-[[(2S,3S)-1,1-diethyl-7-hydroxy-3-methoxy-3,4-dihydro-2H-naphthalen-2-yl]amino]butanoate.
| Compound Name | cyclohexylmethyl 4-[[(2S,3S)-1,1-diethyl-7-hydroxy-3-methoxy-3,4-dihydro-2H-naphthalen-2-yl]amino]butanoate |
|---|---|
| PubChem CID | 42633464 |
| Molecular Formula | C26H41NO4 |
| Molecular Weight | 431.62 g/mol |
| Exact Mass | 431.30 |
| IUPAC Name | cyclohexylmethyl 4-[[(2S,3S)-1,1-diethyl-7-hydroxy-3-methoxy-3,4-dihydro-2H-naphthalen-2-yl]amino]butanoate |
| SMILES | CCC1(CC)c2cc(O)ccc2C[C@H](OC)[C@H]1NCCCC(=O)OCC1CCCCC1 |
| InChI | InChI=1S/C26H41NO4/c1-4-26(5-2)22-17-21(28)14-13-20(22)16-23(30-3)25(26)27-15-9-12-24(29)31-18-19-10-7-6-8-11-19/h13-14,17,19,23,25,27-28H,4-12,15-16,18H2,1-3H3/t23-,25+/m0/s1 |
| InChIKey | GAGJDQMYXUVCHW-UKILVPOCSA-N |
| XLogP | 4.88 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.62 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|