C22H36N2O3 — CID 66674337
2-[[(2R,3R)-1,1-diethyl-7-hydroxy-3-methoxy-3,4-dihydro-2H-naphthalen-2-yl]amino]heptanamide (PubChem CID 66674337) has the molecular formula C22H36N2O3 and a molecular weight of 376.54 g/mol. Its IUPAC name is 2-[[(2R,3R)-1,1-diethyl-7-hydroxy-3-methoxy-3,4-dihydro-2H-naphthalen-2-yl]amino]heptanamide.
| Compound Name | 2-[[(2R,3R)-1,1-diethyl-7-hydroxy-3-methoxy-3,4-dihydro-2H-naphthalen-2-yl]amino]heptanamide |
|---|---|
| PubChem CID | 66674337 |
| Molecular Formula | C22H36N2O3 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.27 |
| IUPAC Name | 2-[[(2R,3R)-1,1-diethyl-7-hydroxy-3-methoxy-3,4-dihydro-2H-naphthalen-2-yl]amino]heptanamide |
| SMILES | CCCCCC(NC1[C@H](OC)Cc2ccc(O)cc2C1(CC)CC)C(N)=O |
| InChI | InChI=1S/C22H36N2O3/c1-5-8-9-10-18(21(23)26)24-20-19(27-4)13-15-11-12-16(25)14-17(15)22(20,6-2)7-3/h11-12,14,18-20,24-25H,5-10,13H2,1-4H3,(H2,23,26)/t18?,19-,20?/m1/s1 |
| InChIKey | RMWLFCDLHHLHNB-IOJLRTSASA-N |
| XLogP | 3.41 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|