C19H31N3O2 — CID 66905611
(6S,7S)-8,8-diethyl-6-methoxy-7-[2-(methylamino)ethylamino]-6,7-dihydro-5H-naphthalene-2-carboxamide (PubChem CID 66905611) has the molecular formula C19H31N3O2 and a molecular weight of 333.48 g/mol. Its IUPAC name is (6S,7S)-8,8-diethyl-6-methoxy-7-[2-(methylamino)ethylamino]-6,7-dihydro-5H-naphthalene-2-carboxamide.
| Compound Name | (6S,7S)-8,8-diethyl-6-methoxy-7-[2-(methylamino)ethylamino]-6,7-dihydro-5H-naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 66905611 |
| Molecular Formula | C19H31N3O2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.24 |
| IUPAC Name | (6S,7S)-8,8-diethyl-6-methoxy-7-[2-(methylamino)ethylamino]-6,7-dihydro-5H-naphthalene-2-carboxamide |
| SMILES | CCC1(CC)c2cc(C(N)=O)ccc2C[C@H](OC)C1NCCNC |
| InChI | InChI=1S/C19H31N3O2/c1-5-19(6-2)15-11-14(18(20)23)8-7-13(15)12-16(24-4)17(19)22-10-9-21-3/h7-8,11,16-17,21-22H,5-6,9-10,12H2,1-4H3,(H2,20,23)/t16-,17?/m0/s1 |
| InChIKey | BVQPMYISRZQFFM-BHWOMJMDSA-N |
| XLogP | 1.59 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|