C13F18 — CID 4263774
1,1,2,2,4,5,6,7-octafluoro-3,3-bis(1,1,2,2,2-pentafluoroethyl)indene (PubChem CID 4263774) has the molecular formula C13F18 and a molecular weight of 498.11 g/mol. Its IUPAC name is 1,1,2,2,4,5,6,7-octafluoro-3,3-bis(1,1,2,2,2-pentafluoroethyl)indene.
| Compound Name | 1,1,2,2,4,5,6,7-octafluoro-3,3-bis(1,1,2,2,2-pentafluoroethyl)indene |
|---|---|
| PubChem CID | 4263774 |
| Molecular Formula | C13F18 |
| Molecular Weight | 498.11 g/mol |
| Exact Mass | 497.97 |
| IUPAC Name | 1,1,2,2,4,5,6,7-octafluoro-3,3-bis(1,1,2,2,2-pentafluoroethyl)indene |
| SMILES | Fc1c(F)c(F)c2c(c1F)C(F)(F)C(F)(F)C2(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13F18/c14-3-1-2(4(15)6(17)5(3)16)8(18,19)9(20,21)7(1,10(22,23)12(26,27)28)11(24,25)13(29,30)31 |
| InChIKey | RTIIMQBZZBZVAZ-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.11 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|