C10Cl2F8 — CID 12696019
3-(dichloromethylidene)-1,1,2,2,4,5,6,7-octafluoroindene (PubChem CID 12696019) has the molecular formula C10Cl2F8 and a molecular weight of 343.00 g/mol. Its IUPAC name is 3-(dichloromethylidene)-1,1,2,2,4,5,6,7-octafluoroindene.
| Compound Name | 3-(dichloromethylidene)-1,1,2,2,4,5,6,7-octafluoroindene |
|---|---|
| PubChem CID | 12696019 |
| Molecular Formula | C10Cl2F8 |
| Molecular Weight | 343.00 g/mol |
| Exact Mass | 341.92 |
| IUPAC Name | 3-(dichloromethylidene)-1,1,2,2,4,5,6,7-octafluoroindene |
| SMILES | Fc1c(F)c(F)c2c(c1F)C(=C(Cl)Cl)C(F)(F)C2(F)F |
| InChI | InChI=1S/C10Cl2F8/c11-8(12)3-1-2(9(17,18)10(3,19)20)5(14)7(16)6(15)4(1)13 |
| InChIKey | QDNZFJJAXHTARC-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.00 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|