C10Cl3F9 — CID 12516166
1,1,2-trichloro-3,3,4,5,6,7-hexafluoro-2-(trifluoromethyl)indene (PubChem CID 12516166) has the molecular formula C10Cl3F9 and a molecular weight of 397.45 g/mol. Its IUPAC name is 1,1,2-trichloro-3,3,4,5,6,7-hexafluoro-2-(trifluoromethyl)indene.
| Compound Name | 1,1,2-trichloro-3,3,4,5,6,7-hexafluoro-2-(trifluoromethyl)indene |
|---|---|
| PubChem CID | 12516166 |
| Molecular Formula | C10Cl3F9 |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 395.89 |
| IUPAC Name | 1,1,2-trichloro-3,3,4,5,6,7-hexafluoro-2-(trifluoromethyl)indene |
| SMILES | Fc1c(F)c(F)c2c(c1F)C(F)(F)C(Cl)(C(F)(F)F)C2(Cl)Cl |
| InChI | InChI=1S/C10Cl3F9/c11-7(12)1-2(4(15)6(17)5(16)3(1)14)8(18,19)9(7,13)10(20,21)22 |
| InChIKey | HMLOXUWQAZWMPP-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|