C9Cl2F8 — CID 13179245
1,3-dichloro-1,2,2,3,4,5,6,7-octafluoroindene (PubChem CID 13179245) has the molecular formula C9Cl2F8 and a molecular weight of 330.99 g/mol. Its IUPAC name is 1,3-dichloro-1,2,2,3,4,5,6,7-octafluoroindene.
| Compound Name | 1,3-dichloro-1,2,2,3,4,5,6,7-octafluoroindene |
|---|---|
| PubChem CID | 13179245 |
| Molecular Formula | C9Cl2F8 |
| Molecular Weight | 330.99 g/mol |
| Exact Mass | 329.92 |
| IUPAC Name | 1,3-dichloro-1,2,2,3,4,5,6,7-octafluoroindene |
| SMILES | Fc1c(F)c(F)c2c(c1F)C(F)(Cl)C(F)(F)C2(F)Cl |
| InChI | InChI=1S/C9Cl2F8/c10-7(16)1-2(8(11,17)9(7,18)19)4(13)6(15)5(14)3(1)12 |
| InChIKey | FBMGEXLQSWBYSI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.99 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|