C10Cl2F10 — CID 631358
1,3-dichloro-1,2,2,4,5,6,7-heptafluoro-3-(trifluoromethyl)indene (PubChem CID 631358) has the molecular formula C10Cl2F10 and a molecular weight of 381.00 g/mol. Its IUPAC name is 1,3-dichloro-1,2,2,4,5,6,7-heptafluoro-3-(trifluoromethyl)indene.
| Compound Name | 1,3-dichloro-1,2,2,4,5,6,7-heptafluoro-3-(trifluoromethyl)indene |
|---|---|
| PubChem CID | 631358 |
| Molecular Formula | C10Cl2F10 |
| Molecular Weight | 381.00 g/mol |
| Exact Mass | 379.92 |
| IUPAC Name | 1,3-dichloro-1,2,2,4,5,6,7-heptafluoro-3-(trifluoromethyl)indene |
| SMILES | Fc1c(F)c(F)c2c(c1F)C(F)(Cl)C(F)(F)C2(Cl)C(F)(F)F |
| InChI | InChI=1S/C10Cl2F10/c11-7(10(20,21)22)1-2(8(12,17)9(7,18)19)4(14)6(16)5(15)3(1)13 |
| InChIKey | UQCHWUJAVSSRJY-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.00 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|