C20H22N4O4S — CID 42641377
1-ethyl-3-[[4-(3-hydroxy-5-methoxyanilino)quinolin-6-yl]-methyl-oxo-λ6-sulfanylidene]urea (PubChem CID 42641377) has the molecular formula C20H22N4O4S and a molecular weight of 414.49 g/mol. Its IUPAC name is 1-ethyl-3-[[4-(3-hydroxy-5-methoxyanilino)quinolin-6-yl]-methyl-oxo-λ6-sulfanylidene]urea.
| Compound Name | 1-ethyl-3-[[4-(3-hydroxy-5-methoxyanilino)quinolin-6-yl]-methyl-oxo-λ6-sulfanylidene]urea |
|---|---|
| PubChem CID | 42641377 |
| Molecular Formula | C20H22N4O4S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 1-ethyl-3-[[4-(3-hydroxy-5-methoxyanilino)quinolin-6-yl]-methyl-oxo-λ6-sulfanylidene]urea |
| SMILES | CCNC(=O)N=S(C)(=O)c1ccc2nccc(Nc3cc(O)cc(OC)c3)c2c1 |
| InChI | InChI=1S/C20H22N4O4S/c1-4-21-20(26)24-29(3,27)16-5-6-18-17(12-16)19(7-8-22-18)23-13-9-14(25)11-15(10-13)28-2/h5-12,25H,4H2,1-3H3,(H,21,26)(H,22,23) |
| InChIKey | CIIPMHKAGRFQDH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |