C12H25NO2S — CID 42644745
methyl (1Z,2S)-N-[(R)-tert-butylsulfinyl]-2-ethylpentanimidate (PubChem CID 42644745) has the molecular formula C12H25NO2S and a molecular weight of 247.40 g/mol. Its IUPAC name is methyl (1Z,2S)-N-[(R)-tert-butylsulfinyl]-2-ethylpentanimidate.
| Compound Name | methyl (1Z,2S)-N-[(R)-tert-butylsulfinyl]-2-ethylpentanimidate |
|---|---|
| PubChem CID | 42644745 |
| Molecular Formula | C12H25NO2S |
| Molecular Weight | 247.40 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | methyl (1Z,2S)-N-[(R)-tert-butylsulfinyl]-2-ethylpentanimidate |
| SMILES | CCC[C@H](CC)/C(=N/[S@](=O)C(C)(C)C)OC |
| InChI | InChI=1S/C12H25NO2S/c1-7-9-10(8-2)11(15-6)13-16(14)12(3,4)5/h10H,7-9H2,1-6H3/b13-11-/t10-,16+/m0/s1 |
| InChIKey | HOMUZAYNIPXOPE-HGZZUCKGSA-N |
| XLogP | 3.32 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|