C18H18N2O4S — CID 42646314
3-[(2-aminophenyl)sulfanyl-(2-nitrophenyl)methyl]pentane-2,4-dione (PubChem CID 42646314) has the molecular formula C18H18N2O4S and a molecular weight of 358.42 g/mol. Its IUPAC name is 3-[(2-aminophenyl)sulfanyl-(2-nitrophenyl)methyl]pentane-2,4-dione.
| Compound Name | 3-[(2-aminophenyl)sulfanyl-(2-nitrophenyl)methyl]pentane-2,4-dione |
|---|---|
| PubChem CID | 42646314 |
| Molecular Formula | C18H18N2O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 3-[(2-aminophenyl)sulfanyl-(2-nitrophenyl)methyl]pentane-2,4-dione |
| SMILES | CC(=O)C(C(C)=O)C(Sc1ccccc1N)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H18N2O4S/c1-11(21)17(12(2)22)18(25-16-10-6-4-8-14(16)19)13-7-3-5-9-15(13)20(23)24/h3-10,17-18H,19H2,1-2H3 |
| InChIKey | SEMPHTIVGMZJLL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|