C18H16Cl3NO2S — CID 42646816
3-[(2-amino-4-chlorophenyl)sulfanyl-(2,4-dichlorophenyl)methyl]pentane-2,4-dione (PubChem CID 42646816) has the molecular formula C18H16Cl3NO2S and a molecular weight of 416.76 g/mol. Its IUPAC name is 3-[(2-amino-4-chlorophenyl)sulfanyl-(2,4-dichlorophenyl)methyl]pentane-2,4-dione.
| Compound Name | 3-[(2-amino-4-chlorophenyl)sulfanyl-(2,4-dichlorophenyl)methyl]pentane-2,4-dione |
|---|---|
| PubChem CID | 42646816 |
| Molecular Formula | C18H16Cl3NO2S |
| Molecular Weight | 416.76 g/mol |
| Exact Mass | 415.00 |
| IUPAC Name | 3-[(2-amino-4-chlorophenyl)sulfanyl-(2,4-dichlorophenyl)methyl]pentane-2,4-dione |
| SMILES | CC(=O)C(C(C)=O)C(Sc1ccc(Cl)cc1N)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H16Cl3NO2S/c1-9(23)17(10(2)24)18(13-5-3-11(19)7-14(13)21)25-16-6-4-12(20)8-15(16)22/h3-8,17-18H,22H2,1-2H3 |
| InChIKey | QIZKVQLKCKEKIQ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.76 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|