C13H13N3O3Se — CID 42647681
2-amino-7-(4-hydroxy-3-methoxyphenyl)-6,7-dihydro-4H-[1,3]selenazolo[4,5-b]pyridin-5-one (PubChem CID 42647681) has the molecular formula C13H13N3O3Se and a molecular weight of 338.23 g/mol. Its IUPAC name is 2-amino-7-(4-hydroxy-3-methoxyphenyl)-6,7-dihydro-4H-[1,3]selenazolo[4,5-b]pyridin-5-one.
| Compound Name | 2-amino-7-(4-hydroxy-3-methoxyphenyl)-6,7-dihydro-4H-[1,3]selenazolo[4,5-b]pyridin-5-one |
|---|---|
| PubChem CID | 42647681 |
| Molecular Formula | C13H13N3O3Se |
| Molecular Weight | 338.23 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 2-amino-7-(4-hydroxy-3-methoxyphenyl)-6,7-dihydro-4H-[1,3]selenazolo[4,5-b]pyridin-5-one |
| SMILES | COc1cc(C2CC(=O)Nc3nc(N)[se]c32)ccc1O |
| InChI | InChI=1S/C13H13N3O3Se/c1-19-9-4-6(2-3-8(9)17)7-5-10(18)15-12-11(7)20-13(14)16-12/h2-4,7,17H,5H2,1H3,(H2,14,16)(H,15,18) |
| InChIKey | JBDJSJOMJKGPFO-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.23 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|