C25H29ClN4O2S — CID 42664810
(4-butoxyphenyl)-[4-[3-[(4-chlorophenyl)methyl]-1,2,4-thiadiazol-5-yl]-2-methylpiperazin-1-yl]methanone (PubChem CID 42664810) has the molecular formula C25H29ClN4O2S and a molecular weight of 485.05 g/mol. Its IUPAC name is (4-butoxyphenyl)-[4-[3-[(4-chlorophenyl)methyl]-1,2,4-thiadiazol-5-yl]-2-methylpiperazin-1-yl]methanone.
| Compound Name | (4-butoxyphenyl)-[4-[3-[(4-chlorophenyl)methyl]-1,2,4-thiadiazol-5-yl]-2-methylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 42664810 |
| Molecular Formula | C25H29ClN4O2S |
| Molecular Weight | 485.05 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | (4-butoxyphenyl)-[4-[3-[(4-chlorophenyl)methyl]-1,2,4-thiadiazol-5-yl]-2-methylpiperazin-1-yl]methanone |
| SMILES | CCCCOc1ccc(C(=O)N2CCN(c3nc(Cc4ccc(Cl)cc4)ns3)CC2C)cc1 |
| InChI | InChI=1S/C25H29ClN4O2S/c1-3-4-15-32-22-11-7-20(8-12-22)24(31)30-14-13-29(17-18(30)2)25-27-23(28-33-25)16-19-5-9-21(26)10-6-19/h5-12,18H,3-4,13-17H2,1-2H3 |
| InChIKey | LTIFRXCXOFQPNJ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.05 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|